Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Theogallin: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 12:55, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 470072924 of page Theogallin for the Chem/Drugbox validation project (updated: 'StdInChI', 'CASNo').  Latest revision as of 05:16, 11 February 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,058 edits Added bibcode. | Use this bot. | #UCB_Other 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 400360350
| Watchedfields = changed
| verifiedrevid = 470606125
| Name = Theogallin | Name = Theogallin
| ImageFile = Theogallin.PNG | ImageFile = Theogallin.svg
| ImageSize = 200px
| ImageName = Chemical structure of theogallin | ImageName = Chemical structure of theogallin
| ImageAlt = Chemical structure of theogallin | ImageAlt = Chemical structure of theogallin
| IUPACName = (1''S'',3''R'',4''R'',5''R'')-1,3,4-trihydroxy-5-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid | PIN = (1''S'',3''R'',4''R'',5''R'')-1,3,4-Trihydroxy-5-cyclohexane-1-carboxylic acid
| OtherNames = 3-''O''-]]<!-- <br> --> | OtherNames = 3-''O''-]]<!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 17365-11-6 -->
| CASNo_Ref = | CASNo = 17365-11-6
| CASOther = | CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 442988
| UNII = N8GTS57R32
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 442988
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 391291 | ChemSpiderID = 391291
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9522 | ChEBI = 9522
| SMILES = O=C(O)2(O)C(O)(O)(OC(=O)c1cc(O)c(O)c(O)c1)C2 | SMILES = O=C(O)2(O)C(O)(O)(OC(=O)c1cc(O)c(O)c(O)c1)C2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H16O10/c15-6-1-5(2-7(16)10(6)18)12(20)24-9-4-14(23,13(21)22)3-8(17)11(9)19/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11-,14+/m1/s1 | StdInChI = 1S/C14H16O10/c15-6-1-5(2-7(16)10(6)18)12(20)24-9-4-14(23,13(21)22)3-8(17)11(9)19/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11-,14+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LDPLFHGGZNSKDS-FTBFGRRBSA-N | StdInChIKey = LDPLFHGGZNSKDS-FTBFGRRBSA-N
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>14</sub>H<sub>16</sub>O<sub>10</sub> | Formula = C<sub>14</sub>H<sub>16</sub>O<sub>10</sub>
| MolarMass = 344.27 g/mol | MolarMass = 344.27 g/mol
| ExactMass = 344.074347 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
}} }}

'''Theogallin''' is a ] ], a type of polyphenolic compound found in tea<ref>{{cite journal | last1 = Cartwright | first1 = R. A. | last2 = Roberts | first2 = E. A. H. | title = Theogallin, a polyphenol occurring in tea | journal = Journal of the Science of Food and Agriculture | volume = 5 | pages = 593 | year = 1954 | doi = 10.1002/jsfa.2740051207 | issue = 12| bibcode = 1954JSFA....5..593C }}</ref> where it has been characterised as an ] enhancing compound.<ref>{{cite book | last1 = Kaneko | first1 = S | last2 = Kumazawa | first2 = K | last3 = Masuda | first3 = H | last4 = Henze | first4 = A | last5 = Hofmann | first5 = T | title = Flavour Science - Recent Advances and Trends | url-status = | volume = 43 | pages = 181 | year = 2006 | doi = 10.1016/S0167-4501(06)80043-9 | chapter = Sensory and structural characterisation of an umami enhancing compound in green tea (mat-cha) | series = Developments in Food Science | isbn = 978-0-444-52742-4}}{{deadlink|date=September 2023}}</ref> The compound can also be found in '']'' fruits.<ref>{{cite journal | url = http://www.wikigenes.org/e/ref/e/17177565.html | title = Phenolics of Arbutus unedo L. (Ericaceae) fruits: identification of anthocyanins and gallic acid derivatives | author = Pawlowska, A.M., De Leo, M., Braca, A. | journal = J. Agric. Food Chem. | year = 2006 | doi = 10.1021/jf062230o | pmid=17177565 | volume = 54 | issue = 26 | pages = 10234–8}}</ref>

In rats, theogallin, or its metabolite ], can move through the ] and can have cognition enhancing activities.<ref>{{cite journal | last1 = Dimpfel | first1 = Wilfried | last2 = Kler | first2 = Adolf | last3 = Kriesl | first3 = Erwin | last4 = Lehnfeld | first4 = Romanus | title = Theogallin and l-theanine as active ingredients in decaffeinated green tea extract: II. Characterization in the freely moving rat by means of quantitative field potential analysis | journal = Journal of Pharmacy and Pharmacology | volume = 59 | issue = 10 | pages = 1397–403 | year = 2007 | pmid = 17910815 | doi = 10.1211/jpp.59.10.0010| s2cid = 33938157 | doi-access = free }}</ref>

== References ==
{{reflist}}

{{Phenolic acid}}

]
]

{{aromatic-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Theogallin: Difference between pages Add topic