| Revision as of 15:36, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 06:47, 10 September 2023 edit undoCrafterNova (talk | contribs)Extended confirmed users16,642 edits +synonymTag: 2017 wikitext editor |
| (13 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 411950829 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Thromboxane B2.svg |
|
|
⚫ |
| verifiedrevid = 428769862 |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| ImageFile=Thromboxane B2.svg |
| ⚫ |
|ImageFileL2=ThromboxaneB2 spacefill.png |
|
|
⚫ |
| ImageSize=250px |
| ⚫ |
|ImageFileR2=ThromboxaneB2.png |
|
|
⚫ |
| ImageFileL2=ThromboxaneB2 spacefill.png |
|
|IUPACName= |
|
|
⚫ |
| ImageFileR2=ThromboxaneB2.png |
| ⚫ |
|OtherNames= |
|
|
|
| PIN=(5''Z'')-7-<nowiki/>{(2''R'',3''S'',4''S'',6''Ξ'')-4,6-Dihydroxy-2-oxan-2-yl}hept-5-enoic acid |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| CASNo=54397-85-2 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=5283137 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| SMILES= |
|
|
⚫ |
| CASNo=54397-85-2 |
| ⚫ |
| MeSHName=Thromboxane+B2 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = V94M3R26ZV |
|
⚫ |
| PubChem=5283137 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 28728 |
|
|
| SMILES= CCCCC(O)\C=C\1OC(O)C(O)1C\C=C/CCCC(O)=O |
|
⚫ |
| MeSHName=Thromboxane+B2 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>34</sub>O<sub>6</sub> |
|
| Formula=C<sub>20</sub>H<sub>34</sub>O<sub>6</sub> |
|
| MolarMass=370.48 g/mol |
|
| MolarMass=370.48 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Thromboxane B2''' is an inactive metabolite/product of ]. It is almost completely cleared in the urine. |
|
'''Thromboxane B2''' ('''TXB2''') is an inactive metabolite/product of ]. It is almost completely cleared in the urine. |
|
|
|
|
|
It itself is not involved in platelet activation and aggregation in case of a wound, but its precursor, thromboxane A2, is. Thromboxane A2 synthesis is the target of the drug ], which inhibits the ] enzyme (the source of thromboxane A2 in platelets). <ref name="urlDefinition: thromboxane b2 from Online Medical Dictionary">{{cite web |url=http://cancerweb.ncl.ac.uk/cgi-bin/omd?thromboxane+b2 |title=Definition: thromboxane b2 from Online Medical Dictionary |format= |work= |accessdate=2008-11-02}}</ref> |
|
It itself is not involved in platelet activation and aggregation in case of a wound, but its precursor, thromboxane A2, is. Thromboxane A2 synthesis is the target of the drug ], which inhibits the ] enzyme (the source of thromboxane A2 in platelets). <ref name="urlDefinition: thromboxane b2 from Online Medical Dictionary">{{cite web |url=http://cancerweb.ncl.ac.uk/cgi-bin/omd?thromboxane+b2 |title=Definition: thromboxane b2 from Online Medical Dictionary |format= |accessdate=2008-11-02}}</ref> |
|
|
|
|
|
|
] (DHPE) is a phenolic component of ]. An olive oil fraction containing DHPE can inhibit ] and thromboxane B2 formation in vitro.<ref>Inhibition of platelet aggregation and eicosanoid production by phenolic components of olive oil. Anna Petroni, Milena Blasevich, Marco Salami, Nadia Papini, Gian F. Montedoro and Claudio Gallia, ], 15 April 1995, Volume 78, Issue 2, Pages 151–160, {{doi|10.1016/0049-3848(95)00043-7}}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|