Misplaced Pages

Thunberginol D: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 08:36, 23 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm 147517-07-5← Previous edit Latest revision as of 14:46, 19 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,990 editsm Added UNII 
(21 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 442872568
| Name = Thunberginol D | Name = Thunberginol D
| ImageFile = Thunberginol D.png | ImageFile = Thunberginol D.svg
| ImageSize = 200px | ImageSize = 200px
| ImageName = Chemical structure of thunberginol D | ImageName = Chemical structure of thunberginol D
Line 7: Line 9:
| IUPACName = 3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydroisochromen-1-one | IUPACName = 3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydroisochromen-1-one
| OtherNames = <!-- <br> --> | OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 147517-07-5 | CASNo = 147517-07-5
| CASNo_Ref = | CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| CASOther =
| UNII = JJX5KK3ZKU
| PubChem = 188928 | PubChem = 188928
| ChemSpiderID = 164167
| SMILES = C1C(OC(=O)C2=C(C=C(C=C21)O)O)C3=CC(=C(C=C3)O)O
| SMILES = c1cc(c(cc1C2Cc3cc(cc(c3C(=O)O2)O)O)O)O
| InChI =
| StdInChI = 1S/C15H12O6/c16-9-3-8-5-13(7-1-2-10(17)11(18)4-7)21-15(20)14(8)12(19)6-9/h1-4,6,13,16-19H,5H2
| StdInChIKey = NNFSGOSBNORREV-UHFFFAOYSA-N
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>6</sub> | Formula = C<sub>15</sub>H<sub>12</sub>O<sub>6</sub>
| MolarMass = 288.25 g/mol | MolarMass = 288.25 g/mol
| ExactMass = 288.063388 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
}} }}
}} }}
'''Thunberginol D''' is an ] found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''] var. thunbergii''.<ref>Thunberginols C, D, and E, new antiallergic and antimicrobial dihydroisocoumarins, and thunberginol G 3'-O-glucoside and (-)-hydrangenol 4'-O-glucoside, new dihydroisocoumarin glycosides, from Hydrangeae Dulcis Folium. '''Thunberginol D''' is a ] found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''] var. thunbergii''.<ref>{{Cite journal
| last1 = Yoshikawa | first1 = M.
Yoshikawa M, Uchida E, Chatani N, Kobayashi H, Naitoh Y, Okuno Y, Matsuda H, Yamahara J and Murakami N. Chem Pharm Bull (Tokyo). 1992 Dec;40(12), pp. 3352-3354, {{PMID|1363465}}</ref>
| last2 = Uchida | first2 = E.
| last3 = Chatani | first3 = N.
| last4 = Kobayashi | first4 = H.
| last5 = Naitoh | first5 = Y.
| last6 = Okuno | first6 = Y.
| last7 = Matsuda | first7 = H.
| last8 = Yamahara | first8 = J.
| last9 = Murakami | first9 = N.
| title = Thunberginols C, D, and E, New Antiallergic and Antimicrobial Dihydroisocoumarins, and Thunberginol G 3'-O-Glucoside and (-)-Hydrangenol 4'-O-Glucoside, New Dihydroisocoumarin Glycosides, from ''Hydrangeae Dulcis Folium''
| journal = Chemical and Pharmaceutical Bulletin
| volume = 40
| issue = 12
| pages = 3352–3354
| year = 1992
| pmid = 1363465
| doi = 10.1248/cpb.40.3352
| url = http://www.jstage.jst.go.jp/article/cpb1958/40/12/40_12_3352/_pdf
| format = pdf
| doi-access = free
}}</ref>


==References== == References ==
{{reflist}} {{Reflist}}


{{Isocoumarin}} {{Isocoumarin}}


] ]
]



{{Natural-phenol-stub}}
{{aromatic-stub}}
Thunberginol D: Difference between revisions Add topic