Revision as of 20:31, 3 June 2011 editLuckas-bot (talk | contribs)929,662 editsm r2.7.1) (robot Adding: fr:Tiglyl-coenzyme A← Previous edit |
Latest revision as of 20:37, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,895 edits fix mistake, add semisystematic nameTag: nowiki added |
(22 intermediate revisions by 12 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 265864648 |
|
| verifiedrevid = 432413654 |
|
|ImageFile=tiglyl-CoA.png |
|
| ImageFile=tiglyl-CoA.png |
|
|ImageSize=250px |
|
| ImageSize=250px |
|
|IUPACName= <small>''S''-methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] (''E'')-2-methylbut-2-enethioate</small> |
|
|
|
| IUPACName=3′-''O''-Phosphonoadenosine 5′-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl dihydrogen diphosphate] |
⚫ |
|OtherNames= |
|
|
|
| SystematicName=''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=6247-62-7 |
|
| CASNo=6247-62-7 |
|
| PubChem=6443760 |
|
| PubChem=6443760 |
|
| SMILES=C\C=C(/C)\C(=O)SCCNC(=O)CCNC(=O) (C(C)(C)COP(=O)(O)OP(=O)(O)OC1 (((O1)N2C=NC3=C2N=CN=C3N) O)OP(=O)(O)O)O |
|
| SMILES = C\C=C(/C)\C(=O)SCCNC(=O)CCNC(=O)(C(C)(C)COP(=O)(O)OP(=O)(O)OC1(((O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O |
|
| MeSHName=tiglyl-coenzyme+A |
|
| MeSHName=tiglyl-coenzyme+A |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
| MolarMass=849.63 g/mol |
|
| MolarMass=849.63 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Tiglyl-CoA''' is an intermediate in the metabolism of ].<ref>{{cite journal|title=TIGLYL COENZYME A AND a-METHYLACETOACETYL COENZYME A, INTERMEDIATES IN THE ENZYMATIC DEGRADATION OF ISOLEUCINE|journal=Journal of Biological Chemistry|volume=218|issue=1|pages=391–400|pmid=13278346|year=1956|author1=ROBINSON WG|author2=BACHHAWAT BK|author3=COON MJ|doi=10.1016/S0021-9258(18)65902-2|doi-access=free}}</ref><ref>{{Cite web|url=http://www.hmdb.ca/metabolites/HMDB02054|title=Showing metabocard for Tiglyl-CoA (HMDB02054)|publisher=The Metabolomics Innovation Centre (TMIC)}}</ref> It is an inhibitor of ].<ref>{{cite journal|title=Inhibition by propionyl-coenzyme A of N-acetylglutamate synthetase in rat liver mitochondria. A possible explanation for hyperammonemia in propionic and methylmalonic acidemia|journal=Journal of Clinical Investigation|volume=64|issue=6|pages=1544–1551|doi=10.1172/JCI109614|pmid=500823|pmc=371306|year=1979|last1=Coude|first1=F X|last2=Sweetman|first2=L|last3=Nyhan|first3=W L}}</ref> |
|
'''Tiglyl-CoA''' is an intermediate in the metabolism of ]. |
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|