Revision as of 22:52, 8 February 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Quick-adding category Benzamides (using HotCat)← Previous edit | Latest revision as of 22:14, 10 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix | ||
(29 intermediate revisions by 21 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} | |||
{{Drugbox | {{Drugbox | ||
| Verifiedfields = changed | |||
⚫ | | IUPAC_name |
||
| Watchedfields = changed | |||
⚫ | | image |
||
| verifiedrevid = 408354833 | |||
⚫ | | CAS_number |
||
⚫ | | IUPAC_name = 2--''N''-hydroxyacetamide | ||
⚫ | | ATC_prefix |
||
⚫ | | image = oxametacin.png | ||
⚫ | | ATC_suffix |
||
| image_class = skin-invert-image | |||
⚫ | | PubChem |
||
⚫ | | DrugBank |
||
<!--Clinical data--> | |||
⚫ | | C=19|H=17|Cl=1|N=2|O=4 | ||
| tradename = | |||
| molecular_weight = 372.80228 g/mol | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
⚫ | | bioavailability |
||
⚫ | | pregnancy_US = <!-- A / B / C / D / X --> | ||
| protein_bound = | |||
| pregnancy_category = | |||
⚫ | | metabolism |
||
⚫ | | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | ||
⚫ | | elimination_half-life = | ||
⚫ | | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | ||
⚫ | | excretion |
||
| |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | ||
| |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | ||
| |
| legal_status = | ||
⚫ | | routes_of_administration = | ||
⚫ | | legal_AU |
||
⚫ | | legal_CA |
||
<!--Pharmacokinetic data--> | |||
⚫ | | |
||
⚫ | | bioavailability = | ||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| |
| protein_bound = | ||
⚫ | | metabolism = | ||
⚫ | | routes_of_administration = | ||
⚫ | | elimination_half-life = | ||
⚫ | | excretion = | ||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|correct|CAS}} | |||
⚫ | | CAS_number = 27035-30-9 | ||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | |||
| ChemSpiderID = 31057 | |||
⚫ | | ATC_prefix = M01 | ||
⚫ | | ATC_suffix = AB13 | ||
⚫ | | PubChem = 33675 | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
⚫ | | DrugBank = | ||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 8G02RSW5CM | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D07266 | |||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = 76255 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = 295829 | |||
<!--Chemical data--> | |||
⚫ | | C=19 | H=17 | Cl=1 | N=2 | O=4 | ||
| smiles = CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)NO | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C19H17ClN2O4/c1-11-15(10-18(23)21-25)16-9-14(26-2)7-8-17(16)22(11)19(24)12-3-5-13(20)6-4-12/h3-9,25H,10H2,1-2H3,(H,21,23) | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = AJRNYCDWNITGHF-UHFFFAOYSA-N | |||
}} | }} | ||
'''Oxametacin''' (or '''oxamethacin''') is a ].<ref>{{cite book | vauthors = Schweiger J | chapter = Oxametacin | pages = 367–368 | veditors = von Bruchhausen F, Ebel S, Hackenthal E, Holzgrabe U |title=Hagers Handbuch der Pharmazeutischen Praxis: Stoffe L-Z Folgeband 5 |date=1999 |location=Berlin, Heidelberg |isbn=978-3-642-58388-9 |edition= 5th, vollständig neubearbeitete Auflage | language = German | chapter-url = https://books.google.com/books?id=vWIiBgAAQBAJ&dq=Oxametacin&pg=PA368}}</ref> | |||
'''Oxametacin''' (or '''oxamethacin''') is a ]. | |||
Hydrolysis of the amide group is one of the synthetic pathways to ] (). | |||
{{pharma-stub}} | |||
== References == | |||
{{Reflist}} | |||
{{Anti-inflammatory and antirheumatic products}} | {{Anti-inflammatory and antirheumatic products}} | ||
{{Prostanoidergics}} | |||
{{NSAIDs}} | |||
] | ] | ||
] | ] | ||
] | ] | ||
] | ] | ||
] | ] | ||
] | |||
{{musculoskeletal-drug-stub}} | |||
] | |||
] |
Latest revision as of 22:14, 10 January 2025
Chemical compound Pharmaceutical compoundClinical data | |
---|---|
ATC code | |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.043.785 |
Chemical and physical data | |
Formula | C19H17ClN2O4 |
Molar mass | 372.81 g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
| |
(what is this?) (verify) |
Oxametacin (or oxamethacin) is a non-steroidal anti-inflammatory drug.
Hydrolysis of the amide group is one of the synthetic pathways to Deboxamet (ChemDrug).
References
- Schweiger J (1999). "Oxametacin". In von Bruchhausen F, Ebel S, Hackenthal E, Holzgrabe U (eds.). Hagers Handbuch der Pharmazeutischen Praxis: Stoffe L-Z Folgeband 5 (in German) (5th, vollständig neubearbeitete Auflage ed.). Berlin, Heidelberg. pp. 367–368. ISBN 978-3-642-58388-9.
{{cite book}}
: CS1 maint: location missing publisher (link)
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |
This drug article relating to the musculoskeletal system is a stub. You can help Misplaced Pages by expanding it. |