Revision as of 22:17, 18 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 11:08, 23 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,416 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(17 intermediate revisions by 12 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 431364926 |
|
| verifiedrevid = 451224407 |
|
| IUPAC_name = (''RS'')-7-nitro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate |
|
| IUPAC_name = (''RS'')-7-nitro-2-oxo-5-phenyl-2,3-dihydro-1''H''-1,4-benzodiazepine-3-carboxylic acid |
|
| image = Nitrazepate.png |
|
| image = Nitrazepate structure.svg |
|
| width = 250px |
|
| width = 215 |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
|
| chirality = ] |
|
| drug_name = Nitrazepate |
|
| drug_name = |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
Line 18: |
Line 19: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 5571-84-6 |
|
| CAS_number = 5571-84-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = 21740 |
|
|
|
| UNII = 3D69H48U8Q |
|
⚫ |
| PubChem = 21741 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
Line 26: |
Line 30: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=16 | H=11 | N=3 | O=5 |
|
| C=16 | H=11 | N=3 | O=5 |
|
|
| smiles = (C1=CC2=C(C=C1)NC(C(C(O)=O)N=C2C3=CC=CC=C3)=O)=O |
|
| molecular_weight = 325.275 |
|
|
| smiles = c3ccccc3C(=NC1C(O)=O)c2cc((=O)=O)ccc2NC1=O |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H11N3O5/c20-15-14(16(21)22)18-13(9-4-2-1-3-5-9)11-8-10(19(23)24)6-7-12(11)17-15/h1-8,14H,(H,17,20)(H,21,22) |
|
| StdInChI = 1S/C16H11N3O5/c20-15-14(16(21)22)18-13(9-4-2-1-3-5-9)11-8-10(19(23)24)6-7-12(11)17-15/h1-8,14H,(H,17,20)(H,21,22) |
Line 34: |
Line 37: |
|
}} |
|
}} |
|
|
|
|
|
'''Nitrazepate''' ('''Lorzem''') is a drug which is a ] derivative and has ] properties. It is normally produced as its potassium salt, '''potassium nitrazepate'''.<ref>{{Cite web | url = http://www.psychotropics.dk/moleculeView/default.aspx?ID=1404&Catalogtype=A&ChapterID=1&Thissortorder=9 | title = nitrazepate | accessdate = 7 December 2009 | year = 2003 | publisher = psychotropics.dk }}</ref> |
|
'''Nitrazepate''' ('''Lorzem''') is a drug which is a ] derivative and has ] properties. It is normally produced as its potassium salt, '''potassium nitrazepate'''.<ref>{{Cite web | url = http://www.psychotropics.dk/moleculeView/default.aspx?ID=1404&Catalogtype=A&ChapterID=1&Thissortorder=9 | title = nitrazepate | access-date = 7 December 2009 | year = 2003 | publisher = psychotropics.dk }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
Line 43: |
Line 46: |
|
|
|
|
|
{{Benzodiazepines}} |
|
{{Benzodiazepines}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
|
] |
|
⚫ |
] |
|
] |
|
] |
⚫ |
] |
|
|
|
|
|
|
|
|
|
{{sedative-stub}} |
|
{{sedative-stub}} |