Revision as of 08:55, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user← Previous edit | Revision as of 06:30, 1 September 2011 edit undoBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBotNext edit → | ||
Line 1: | Line 1: | ||
{{ |
{{Drugbox | ||
⚫ | | UNII_Ref = {{fdacite|correct|FDA}} | ||
⚫ | | UNII = 0J9L7J6V8C | ||
| verifiedrevid = 444023214 | | verifiedrevid = 444023214 | ||
| IUPAC_name = 2-amino-3-benzoylbenzeneacetamide | | IUPAC_name = 2-amino-3-benzoylbenzeneacetamide | ||
| image = Nepafenac-2D-skeletal.png | | image = Nepafenac-2D-skeletal.png | ||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
<!--Clinical data--> | |||
⚫ | | ChemSpiderID = 133160 | ||
| tradename = | |||
⚫ | | InChI = 1/C15H14N2O2/c16-13(18)9-11-7-4-8-12(14(11)17)15(19)10-5-2-1-3-6-10/h1-8H,9,17H2,(H2,16,18) | ||
| Drugs.com = {{drugs.com|monograph|nepafenac}} | |||
⚫ | | InChIKey = QEFAQIPZVLVERP-UHFFFAOYAP | ||
| MedlinePlus = a606007 | |||
⚫ | | smiles = O=C(c1cccc(c1N)CC(=O)N)c2ccccc2 | ||
⚫ | | pregnancy_category = C | ||
⚫ | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| |
| legal_US = Rx-only | ||
⚫ | | legal_status = | ||
⚫ | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
⚫ | | routes_of_administration = ] | ||
⚫ | | StdInChI = 1S/C15H14N2O2/c16-13(18)9-11-7-4-8-12(14(11)17)15(19)10-5-2-1-3-6-10/h1-8H,9,17H2,(H2,16,18) | ||
⚫ | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
<!--Pharmacokinetic data--> | |||
⚫ | | StdInChIKey = QEFAQIPZVLVERP-UHFFFAOYSA-N | ||
| |
| bioavailability = | ||
⚫ | | protein_bound = | ||
⚫ | | metabolism = | ||
⚫ | | elimination_half-life = | ||
<!--Identifiers--> | |||
| CAS_number = | |||
| ATC_prefix = S01 | | ATC_prefix = S01 | ||
| ATC_suffix = BC10 | | ATC_suffix = BC10 | ||
| ATC_supplemental = | | ATC_supplemental = | ||
| PubChem = 151075 | | PubChem = 151075 | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = DB06802 | | DrugBank = DB06802 | ||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
⚫ | | ChemSpiderID = 133160 | ||
⚫ | | UNII_Ref = {{fdacite|correct|FDA}} | ||
⚫ | | UNII = 0J9L7J6V8C | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = D05143 | | KEGG = D05143 | ||
⚫ | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
⚫ | | C |
||
| ChEMBL = 1021 | |||
<!--Chemical data--> | |||
⚫ | | C=15 | H=14 | N=2 | O=2 | ||
| molecular_weight = 254.28 ]/] | | molecular_weight = 254.28 ]/] | ||
⚫ | | smiles = O=C(c1cccc(c1N)CC(=O)N)c2ccccc2 | ||
| bioavailability = | |||
⚫ | | InChI = 1/C15H14N2O2/c16-13(18)9-11-7-4-8-12(14(11)17)15(19)10-5-2-1-3-6-10/h1-8H,9,17H2,(H2,16,18) | ||
⚫ | | protein_bound = | ||
⚫ | | InChIKey = QEFAQIPZVLVERP-UHFFFAOYAP | ||
⚫ | | metabolism = | ||
⚫ | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
⚫ | | elimination_half-life = | ||
⚫ | | StdInChI = 1S/C15H14N2O2/c16-13(18)9-11-7-4-8-12(14(11)17)15(19)10-5-2-1-3-6-10/h1-8H,9,17H2,(H2,16,18) | ||
⚫ | | pregnancy_category = C | ||
⚫ | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| legal_US = Rx-only | |||
⚫ | | StdInChIKey = QEFAQIPZVLVERP-UHFFFAOYSA-N | ||
⚫ | | legal_status = | ||
⚫ | | routes_of_administration = ] | ||
}} | }} | ||
Revision as of 06:30, 1 September 2011
Pharmaceutical compoundClinical data | |
---|---|
AHFS/Drugs.com | Monograph |
MedlinePlus | a606007 |
Pregnancy category |
|
Routes of administration | Ophthalmic |
ATC code | |
Legal status | |
Legal status |
|
Identifiers | |
IUPAC name
| |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.207.414 |
Chemical and physical data | |
Formula | C15H14N2O2 |
Molar mass | 254.28 g/mol g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
| |
(verify) |
Nepafenac is a non-steroidal anti-inflammatory drug (NSAID), usually sold as a prescription eye drop (0.1% solution. Nepafenac is manufactured by Alcon as Nevanac. It is used to treat pain and inflammation associated with cataract surgery.
The usual dose is 1 drop in each affected eye beginning 1 day prior to cataract surgery, continued on the day of surgery and through the first 2 weeks of the postoperative period.
Its side effects may include decreased visual acuity, a feeling that something is in the eye, increased eye pressure or a sticky sensation, as well as other effects.
External links
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |